C18H30N2O2 — CID 103781124
tert-butyl N-[3-[1-(2-methylphenyl)propan-2-ylamino]propyl]carbamate (PubChem CID 103781124) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(2-methylphenyl)propan-2-ylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(2-methylphenyl)propan-2-ylamino]propyl]carbamate |
|---|---|
| PubChem CID | 103781124 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | tert-butyl N-[3-[1-(2-methylphenyl)propan-2-ylamino]propyl]carbamate |
| SMILES | Cc1ccccc1CC(C)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30N2O2/c1-14-9-6-7-10-16(14)13-15(2)19-11-8-12-20-17(21)22-18(3,4)5/h6-7,9-10,15,19H,8,11-13H2,1-5H3,(H,20,21) |
| InChIKey | SXFVGAGGDZYEJK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|