C54H61N3OSi — CID 57132731
1-[tert-butyl(dimethyl)silyl]oxy-3-(2-butyl-3-tritylimidazol-4-yl)-N-tritylpropan-2-amine (PubChem CID 57132731) has the molecular formula C54H61N3OSi and a molecular weight of 796.19 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-3-(2-butyl-3-tritylimidazol-4-yl)-N-tritylpropan-2-amine.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-(2-butyl-3-tritylimidazol-4-yl)-N-tritylpropan-2-amine |
|---|---|
| PubChem CID | 57132731 |
| Molecular Formula | C54H61N3OSi |
| Molecular Weight | 796.19 g/mol |
| Exact Mass | 795.46 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-(2-butyl-3-tritylimidazol-4-yl)-N-tritylpropan-2-amine |
| SMILES | CCCCc1ncc(CC(CO[Si](C)(C)C(C)(C)C)NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H61N3OSi/c1-7-8-39-51-55-41-50(57(51)54(46-33-21-12-22-34-46,47-35-23-13-24-36-47)48-37-25-14-26-38-48)40-49(42-58-59(5,6)52(2,3)4)56-53(43-27-15-9-16-28-43,44-29-17-10-18-30-44)45-31-19-11-20-32-45/h9-38,41,49,56H,7-8,39-40,42H2,1-6H3 |
| InChIKey | VGGFMEPNBSMXRJ-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.19 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|