C34H40BrNO2Si — CID 139967661
2-bromo-4-[3-[tert-butyl(dimethyl)silyl]oxy-2-(tritylamino)propyl]phenol (PubChem CID 139967661) has the molecular formula C34H40BrNO2Si and a molecular weight of 602.69 g/mol. Its IUPAC name is 2-bromo-4-[3-[tert-butyl(dimethyl)silyl]oxy-2-(tritylamino)propyl]phenol.
| Compound Name | 2-bromo-4-[3-[tert-butyl(dimethyl)silyl]oxy-2-(tritylamino)propyl]phenol |
|---|---|
| PubChem CID | 139967661 |
| Molecular Formula | C34H40BrNO2Si |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 601.20 |
| IUPAC Name | 2-bromo-4-[3-[tert-butyl(dimethyl)silyl]oxy-2-(tritylamino)propyl]phenol |
| SMILES | CC(C)(C)[Si](C)(C)OCC(Cc1ccc(O)c(Br)c1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H40BrNO2Si/c1-33(2,3)39(4,5)38-25-30(23-26-21-22-32(37)31(35)24-26)36-34(27-15-9-6-10-16-27,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6-22,24,30,36-37H,23,25H2,1-5H3 |
| InChIKey | YGTQMCOOFMCUMC-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|