C23H35NO2Si — CID 101474100
(2S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)propan-2-amine (PubChem CID 101474100) has the molecular formula C23H35NO2Si and a molecular weight of 385.62 g/mol. Its IUPAC name is (2S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)propan-2-amine.
| Compound Name | (2S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)propan-2-amine |
|---|---|
| PubChem CID | 101474100 |
| Molecular Formula | C23H35NO2Si |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (2S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-3-(4-methoxyphenyl)propan-2-amine |
| SMILES | COc1ccc(C[C@@H](CO[Si](C)(C)C(C)(C)C)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H35NO2Si/c1-23(2,3)27(5,6)26-18-21(24-17-20-10-8-7-9-11-20)16-19-12-14-22(25-4)15-13-19/h7-15,21,24H,16-18H2,1-6H3/t21-/m0/s1 |
| InChIKey | LCAWMOSCLVAOHS-NRFANRHFSA-N |
| XLogP | 5.42 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|