C18H33NO2SSi — CID 54752710
(2S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-4-methylsulfinylbutan-2-amine (PubChem CID 54752710) has the molecular formula C18H33NO2SSi and a molecular weight of 355.62 g/mol. Its IUPAC name is (2S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-4-methylsulfinylbutan-2-amine.
| Compound Name | (2S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-4-methylsulfinylbutan-2-amine |
|---|---|
| PubChem CID | 54752710 |
| Molecular Formula | C18H33NO2SSi |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (2S)-N-benzyl-1-[tert-butyl(dimethyl)silyl]oxy-4-methylsulfinylbutan-2-amine |
| SMILES | CS(=O)CC[C@@H](CO[Si](C)(C)C(C)(C)C)NCc1ccccc1 |
| InChI | InChI=1S/C18H33NO2SSi/c1-18(2,3)23(5,6)21-15-17(12-13-22(4)20)19-14-16-10-8-7-9-11-16/h7-11,17,19H,12-15H2,1-6H3/t17-,22?/m0/s1 |
| InChIKey | UMXDIQXXHWSAFA-LBOXEOMUSA-N |
| XLogP | 3.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|