C25H45NOSi2 — CID 15530571
(2R,3S,4S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-(2-trimethylsilylethynyl)heptan-3-amine (PubChem CID 15530571) has the molecular formula C25H45NOSi2 and a molecular weight of 431.81 g/mol. Its IUPAC name is (2R,3S,4S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-(2-trimethylsilylethynyl)heptan-3-amine.
| Compound Name | (2R,3S,4S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-(2-trimethylsilylethynyl)heptan-3-amine |
|---|---|
| PubChem CID | 15530571 |
| Molecular Formula | C25H45NOSi2 |
| Molecular Weight | 431.81 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | (2R,3S,4S)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxy-4-(2-trimethylsilylethynyl)heptan-3-amine |
| SMILES | CCC[C@@H](C#C[Si](C)(C)C)[C@H](NCc1ccccc1)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H45NOSi2/c1-11-15-23(18-19-28(6,7)8)24(26-20-22-16-13-12-14-17-22)21(2)27-29(9,10)25(3,4)5/h12-14,16-17,21,23-24,26H,11,15,20H2,1-10H3/t21-,23+,24-/m1/s1 |
| InChIKey | ZQAPBYSYBXZFKA-YFNKSVMNSA-N |
| XLogP | 6.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.81 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|