C22H39NOSi — CID 11371881
(E,2S,5R)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxynon-3-en-5-amine (PubChem CID 11371881) has the molecular formula C22H39NOSi and a molecular weight of 361.65 g/mol. Its IUPAC name is (E,2S,5R)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxynon-3-en-5-amine.
| Compound Name | (E,2S,5R)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxynon-3-en-5-amine |
|---|---|
| PubChem CID | 11371881 |
| Molecular Formula | C22H39NOSi |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | (E,2S,5R)-N-benzyl-2-[tert-butyl(dimethyl)silyl]oxynon-3-en-5-amine |
| SMILES | CCCC[C@H](/C=C/[C@H](C)O[Si](C)(C)C(C)(C)C)NCc1ccccc1 |
| InChI | InChI=1S/C22H39NOSi/c1-8-9-15-21(23-18-20-13-11-10-12-14-20)17-16-19(2)24-25(6,7)22(3,4)5/h10-14,16-17,19,21,23H,8-9,15,18H2,1-7H3/b17-16+/t19-,21+/m0/s1 |
| InChIKey | UQBLFIADLKQLBY-FJGQEFEISA-N |
| XLogP | 6.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|