C21H36O2Si2 — CID 10667277
1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenyl-5-trimethylsilylpent-4-yn-2-ol (PubChem CID 10667277) has the molecular formula C21H36O2Si2 and a molecular weight of 376.69 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenyl-5-trimethylsilylpent-4-yn-2-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenyl-5-trimethylsilylpent-4-yn-2-ol |
|---|---|
| PubChem CID | 10667277 |
| Molecular Formula | C21H36O2Si2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-phenyl-5-trimethylsilylpent-4-yn-2-ol |
| SMILES | CC(C#C[Si](C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H36O2Si2/c1-17(15-16-24(5,6)7)19(22)20(18-13-11-10-12-14-18)23-25(8,9)21(2,3)4/h10-14,17,19-20,22H,1-9H3 |
| InChIKey | HKUQCRZHLGCCQC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|