C27H35O3PSi — CID 24813675
(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-diphenylphosphoryl-1-phenylpropan-2-ol (PubChem CID 24813675) has the molecular formula C27H35O3PSi and a molecular weight of 466.63 g/mol. Its IUPAC name is (1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-diphenylphosphoryl-1-phenylpropan-2-ol.
| Compound Name | (1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-diphenylphosphoryl-1-phenylpropan-2-ol |
|---|---|
| PubChem CID | 24813675 |
| Molecular Formula | C27H35O3PSi |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-diphenylphosphoryl-1-phenylpropan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](c1ccccc1)[C@H](O)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H35O3PSi/c1-27(2,3)32(4,5)30-26(22-15-9-6-10-16-22)25(28)21-31(29,23-17-11-7-12-18-23)24-19-13-8-14-20-24/h6-20,25-26,28H,21H2,1-5H3/t25-,26+/m1/s1 |
| InChIKey | RJOYIDPMMMXJRP-FTJBHMTQSA-N |
| XLogP | 6.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|