C21H31O2PSi — CID 45073674
[(3R)-4-diphenylphosphoryl-2,3-dimethylbutan-2-yl]oxy-trimethylsilane (PubChem CID 45073674) has the molecular formula C21H31O2PSi and a molecular weight of 374.54 g/mol. Its IUPAC name is [(3R)-4-diphenylphosphoryl-2,3-dimethylbutan-2-yl]oxy-trimethylsilane.
| Compound Name | [(3R)-4-diphenylphosphoryl-2,3-dimethylbutan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 45073674 |
| Molecular Formula | C21H31O2PSi |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | [(3R)-4-diphenylphosphoryl-2,3-dimethylbutan-2-yl]oxy-trimethylsilane |
| SMILES | C[C@@H](CP(=O)(c1ccccc1)c1ccccc1)C(C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C21H31O2PSi/c1-18(21(2,3)23-25(4,5)6)17-24(22,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18H,17H2,1-6H3/t18-/m0/s1 |
| InChIKey | ZGIMJAVSURKTDF-SFHVURJKSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|