C22H23O2PS — CID 10091303
(2S,3S)-4-diphenylphosphoryl-3-phenylsulfanylbutan-2-ol (PubChem CID 10091303) has the molecular formula C22H23O2PS and a molecular weight of 382.47 g/mol. Its IUPAC name is (2S,3S)-4-diphenylphosphoryl-3-phenylsulfanylbutan-2-ol.
| Compound Name | (2S,3S)-4-diphenylphosphoryl-3-phenylsulfanylbutan-2-ol |
|---|---|
| PubChem CID | 10091303 |
| Molecular Formula | C22H23O2PS |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (2S,3S)-4-diphenylphosphoryl-3-phenylsulfanylbutan-2-ol |
| SMILES | C[C@H](O)[C@@H](CP(=O)(c1ccccc1)c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C22H23O2PS/c1-18(23)22(26-21-15-9-4-10-16-21)17-25(24,19-11-5-2-6-12-19)20-13-7-3-8-14-20/h2-16,18,22-23H,17H2,1H3/t18-,22+/m0/s1 |
| InChIKey | AMLQTGYJSBKQOH-PGRDOPGGSA-N |
| XLogP | 4.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|