C15H24O2S — CID 101017386
(2S,3R,4S)-2,6-dimethyl-4-phenylsulfanylheptane-1,3-diol (PubChem CID 101017386) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is (2S,3R,4S)-2,6-dimethyl-4-phenylsulfanylheptane-1,3-diol.
| Compound Name | (2S,3R,4S)-2,6-dimethyl-4-phenylsulfanylheptane-1,3-diol |
|---|---|
| PubChem CID | 101017386 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (2S,3R,4S)-2,6-dimethyl-4-phenylsulfanylheptane-1,3-diol |
| SMILES | CC(C)C[C@H](Sc1ccccc1)[C@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C15H24O2S/c1-11(2)9-14(15(17)12(3)10-16)18-13-7-5-4-6-8-13/h4-8,11-12,14-17H,9-10H2,1-3H3/t12-,14-,15+/m0/s1 |
| InChIKey | IRCKQLPFJMXJEG-AEGPPILISA-N |
| XLogP | 3.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |