C21H30OSSi — CID 10428506
(2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexan-1-ol (PubChem CID 10428506) has the molecular formula C21H30OSSi and a molecular weight of 358.62 g/mol. Its IUPAC name is (2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexan-1-ol.
| Compound Name | (2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexan-1-ol |
|---|---|
| PubChem CID | 10428506 |
| Molecular Formula | C21H30OSSi |
| Molecular Weight | 358.62 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexan-1-ol |
| SMILES | CC(C)C[C@H]([C@H](CO)Sc1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H30OSSi/c1-17(2)15-21(24(3,4)19-13-9-6-10-14-19)20(16-22)23-18-11-7-5-8-12-18/h5-14,17,20-22H,15-16H2,1-4H3/t20-,21+/m0/s1 |
| InChIKey | UVBOONLNOOZFAV-LEWJYISDSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|