C21H28OSSi — CID 10428371
(2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexanal (PubChem CID 10428371) has the molecular formula C21H28OSSi and a molecular weight of 356.61 g/mol. Its IUPAC name is (2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexanal.
| Compound Name | (2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexanal |
|---|---|
| PubChem CID | 10428371 |
| Molecular Formula | C21H28OSSi |
| Molecular Weight | 356.61 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2S,3R)-3-[dimethyl(phenyl)silyl]-5-methyl-2-phenylsulfanylhexanal |
| SMILES | CC(C)C[C@H]([C@H](C=O)Sc1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H28OSSi/c1-17(2)15-21(24(3,4)19-13-9-6-10-14-19)20(16-22)23-18-11-7-5-8-12-18/h5-14,16-17,20-21H,15H2,1-4H3/t20-,21+/m0/s1 |
| InChIKey | TVCIZALYLGFNEJ-LEWJYISDSA-N |
| XLogP | 5.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|