C16H23O2Si- — CID 100971033
(3R,4R)-3-[dimethyl(phenyl)silyl]-4-formylhept-6-en-1-olate (PubChem CID 100971033) has the molecular formula C16H23O2Si- and a molecular weight of 275.44 g/mol. Its IUPAC name is (3R,4R)-3-[dimethyl(phenyl)silyl]-4-formylhept-6-en-1-olate.
| Compound Name | (3R,4R)-3-[dimethyl(phenyl)silyl]-4-formylhept-6-en-1-olate |
|---|---|
| PubChem CID | 100971033 |
| Molecular Formula | C16H23O2Si- |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (3R,4R)-3-[dimethyl(phenyl)silyl]-4-formylhept-6-en-1-olate |
| SMILES | C=CC[C@H](C=O)[C@@H](CC[O-])[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H23O2Si/c1-4-8-14(13-18)16(11-12-17)19(2,3)15-9-6-5-7-10-15/h4-7,9-10,13-14,16H,1,8,11-12H2,2-3H3/q-1/t14-,16-/m1/s1 |
| InChIKey | CRAQNRILTRPSLJ-GDBMZVCRSA-N |
| XLogP | 2.11 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|