C20H34O2Si2 — CID 11302957
trimethylsilyl (2R)-2-[(1S)-1-[dimethyl(phenyl)silyl]-2-methylpropyl]pent-4-enoate (PubChem CID 11302957) has the molecular formula C20H34O2Si2 and a molecular weight of 362.66 g/mol. Its IUPAC name is trimethylsilyl (2R)-2-[(1S)-1-[dimethyl(phenyl)silyl]-2-methylpropyl]pent-4-enoate.
| Compound Name | trimethylsilyl (2R)-2-[(1S)-1-[dimethyl(phenyl)silyl]-2-methylpropyl]pent-4-enoate |
|---|---|
| PubChem CID | 11302957 |
| Molecular Formula | C20H34O2Si2 |
| Molecular Weight | 362.66 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | trimethylsilyl (2R)-2-[(1S)-1-[dimethyl(phenyl)silyl]-2-methylpropyl]pent-4-enoate |
| SMILES | C=CC[C@H](C(=O)O[Si](C)(C)C)[C@H](C(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H34O2Si2/c1-9-13-18(20(21)22-23(4,5)6)19(16(2)3)24(7,8)17-14-11-10-12-15-17/h9-12,14-16,18-19H,1,13H2,2-8H3/t18-,19-/m0/s1 |
| InChIKey | XTZHFIMJFZQJDB-OALUTQOASA-N |
| XLogP | 5.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|