C16H22O3Si — CID 101416087
methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-2-(2-oxoethyl)pent-4-enoate (PubChem CID 101416087) has the molecular formula C16H22O3Si and a molecular weight of 290.44 g/mol. Its IUPAC name is methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-2-(2-oxoethyl)pent-4-enoate.
| Compound Name | methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-2-(2-oxoethyl)pent-4-enoate |
|---|---|
| PubChem CID | 101416087 |
| Molecular Formula | C16H22O3Si |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl (2S,3R)-3-[dimethyl(phenyl)silyl]-2-(2-oxoethyl)pent-4-enoate |
| SMILES | C=C[C@H]([C@@H](CC=O)C(=O)OC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H22O3Si/c1-5-15(14(11-12-17)16(18)19-2)20(3,4)13-9-7-6-8-10-13/h5-10,12,14-15H,1,11H2,2-4H3/t14-,15-/m1/s1 |
| InChIKey | NYVHNEWOGXUUJK-HUUCEWRRSA-N |
| XLogP | 2.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|