C19H30O4Si — CID 135776484
dimethyl (2S)-2-[(1S)-1-[dimethyl(phenyl)silyl]-2-methylpropyl]pentanedioate (PubChem CID 135776484) has the molecular formula C19H30O4Si and a molecular weight of 350.53 g/mol. Its IUPAC name is dimethyl (2S)-2-[(1S)-1-[dimethyl(phenyl)silyl]-2-methylpropyl]pentanedioate.
| Compound Name | dimethyl (2S)-2-[(1S)-1-[dimethyl(phenyl)silyl]-2-methylpropyl]pentanedioate |
|---|---|
| PubChem CID | 135776484 |
| Molecular Formula | C19H30O4Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | dimethyl (2S)-2-[(1S)-1-[dimethyl(phenyl)silyl]-2-methylpropyl]pentanedioate |
| SMILES | COC(=O)CC[C@@H](C(=O)OC)[C@H](C(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H30O4Si/c1-14(2)18(24(5,6)15-10-8-7-9-11-15)16(19(21)23-4)12-13-17(20)22-3/h7-11,14,16,18H,12-13H2,1-6H3/t16-,18+/m1/s1 |
| InChIKey | KCIMDYNWGNENJO-AEFFLSMTSA-N |
| XLogP | 3.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|