C25H36O4Si2 — CID 10575797
dimethyl 2-[(1R,3S)-1,3-bis[dimethyl(phenyl)silyl]butyl]propanedioate (PubChem CID 10575797) has the molecular formula C25H36O4Si2 and a molecular weight of 456.73 g/mol. Its IUPAC name is dimethyl 2-[(1R,3S)-1,3-bis[dimethyl(phenyl)silyl]butyl]propanedioate.
| Compound Name | dimethyl 2-[(1R,3S)-1,3-bis[dimethyl(phenyl)silyl]butyl]propanedioate |
|---|---|
| PubChem CID | 10575797 |
| Molecular Formula | C25H36O4Si2 |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | dimethyl 2-[(1R,3S)-1,3-bis[dimethyl(phenyl)silyl]butyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](C[C@H](C)[Si](C)(C)c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H36O4Si2/c1-19(30(4,5)20-14-10-8-11-15-20)18-22(23(24(26)28-2)25(27)29-3)31(6,7)21-16-12-9-13-17-21/h8-17,19,22-23H,18H2,1-7H3/t19-,22+/m0/s1 |
| InChIKey | JOUUGNLMGKUPLM-SIKLNZKXSA-N |
| XLogP | 4.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|