C25H36O8Si — CID 102281471
tetraethyl 4-[dimethyl(phenyl)silyl]pent-1-ene-1,1,5,5-tetracarboxylate (PubChem CID 102281471) has the molecular formula C25H36O8Si and a molecular weight of 492.64 g/mol. Its IUPAC name is tetraethyl 4-[dimethyl(phenyl)silyl]pent-1-ene-1,1,5,5-tetracarboxylate.
| Compound Name | tetraethyl 4-[dimethyl(phenyl)silyl]pent-1-ene-1,1,5,5-tetracarboxylate |
|---|---|
| PubChem CID | 102281471 |
| Molecular Formula | C25H36O8Si |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | tetraethyl 4-[dimethyl(phenyl)silyl]pent-1-ene-1,1,5,5-tetracarboxylate |
| SMILES | CCOC(=O)C(=CCC(C(C(=O)OCC)C(=O)OCC)[Si](C)(C)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C25H36O8Si/c1-7-30-22(26)19(23(27)31-8-2)16-17-20(34(5,6)18-14-12-11-13-15-18)21(24(28)32-9-3)25(29)33-10-4/h11-16,20-21H,7-10,17H2,1-6H3 |
| InChIKey | MICLXJMRZXAGGE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|