C20H30O5Si — CID 52920552
diethyl 2-[(1R,2S)-1-[dimethyl(phenyl)silyl]-2-formylbutyl]propanedioate (PubChem CID 52920552) has the molecular formula C20H30O5Si and a molecular weight of 378.54 g/mol. Its IUPAC name is diethyl 2-[(1R,2S)-1-[dimethyl(phenyl)silyl]-2-formylbutyl]propanedioate.
| Compound Name | diethyl 2-[(1R,2S)-1-[dimethyl(phenyl)silyl]-2-formylbutyl]propanedioate |
|---|---|
| PubChem CID | 52920552 |
| Molecular Formula | C20H30O5Si |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | diethyl 2-[(1R,2S)-1-[dimethyl(phenyl)silyl]-2-formylbutyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]([C@H](C=O)CC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H30O5Si/c1-6-15(14-21)18(26(4,5)16-12-10-9-11-13-16)17(19(22)24-7-2)20(23)25-8-3/h9-15,17-18H,6-8H2,1-5H3/t15-,18+/m0/s1 |
| InChIKey | HVBCWRMIPJLNNL-MAUKXSAKSA-N |
| XLogP | 2.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|