C28H36O2Si2 — CID 10790158
ethyl 2-[tert-butyl(dimethyl)silyl]-2-triphenylsilylacetate (PubChem CID 10790158) has the molecular formula C28H36O2Si2 and a molecular weight of 460.77 g/mol. Its IUPAC name is ethyl 2-[tert-butyl(dimethyl)silyl]-2-triphenylsilylacetate.
| Compound Name | ethyl 2-[tert-butyl(dimethyl)silyl]-2-triphenylsilylacetate |
|---|---|
| PubChem CID | 10790158 |
| Molecular Formula | C28H36O2Si2 |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | ethyl 2-[tert-butyl(dimethyl)silyl]-2-triphenylsilylacetate |
| SMILES | CCOC(=O)C([Si](c1ccccc1)(c1ccccc1)c1ccccc1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H36O2Si2/c1-7-30-26(29)27(31(5,6)28(2,3)4)32(23-17-11-8-12-18-23,24-19-13-9-14-20-24)25-21-15-10-16-22-25/h8-22,27H,7H2,1-6H3 |
| InChIKey | YWEUMYCYLYESFT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|