C23H30O4Si — CID 10620909
dimethyl 2-[(2R,4R)-4-[dimethyl(phenyl)silyl]-4-phenylbutan-2-yl]propanedioate (PubChem CID 10620909) has the molecular formula C23H30O4Si and a molecular weight of 398.58 g/mol. Its IUPAC name is dimethyl 2-[(2R,4R)-4-[dimethyl(phenyl)silyl]-4-phenylbutan-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(2R,4R)-4-[dimethyl(phenyl)silyl]-4-phenylbutan-2-yl]propanedioate |
|---|---|
| PubChem CID | 10620909 |
| Molecular Formula | C23H30O4Si |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | dimethyl 2-[(2R,4R)-4-[dimethyl(phenyl)silyl]-4-phenylbutan-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](C)C[C@H](c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H30O4Si/c1-17(21(22(24)26-2)23(25)27-3)16-20(18-12-8-6-9-13-18)28(4,5)19-14-10-7-11-15-19/h6-15,17,20-21H,16H2,1-5H3/t17-,20-/m1/s1 |
| InChIKey | AHPPOSXWKJHVNQ-YLJYHZDGSA-N |
| XLogP | 3.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|