C17H27NO6Si — CID 10248537
methyl (2R,3S,4R,5R)-3-[dimethyl(phenyl)silyl]-4,5-dihydroxy-2-(methoxycarbonylamino)hexanoate (PubChem CID 10248537) has the molecular formula C17H27NO6Si and a molecular weight of 369.49 g/mol. Its IUPAC name is methyl (2R,3S,4R,5R)-3-[dimethyl(phenyl)silyl]-4,5-dihydroxy-2-(methoxycarbonylamino)hexanoate.
| Compound Name | methyl (2R,3S,4R,5R)-3-[dimethyl(phenyl)silyl]-4,5-dihydroxy-2-(methoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 10248537 |
| Molecular Formula | C17H27NO6Si |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | methyl (2R,3S,4R,5R)-3-[dimethyl(phenyl)silyl]-4,5-dihydroxy-2-(methoxycarbonylamino)hexanoate |
| SMILES | COC(=O)N[C@H](C(=O)OC)[C@@H]([C@H](O)[C@@H](C)O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H27NO6Si/c1-11(19)14(20)15(13(16(21)23-2)18-17(22)24-3)25(4,5)12-9-7-6-8-10-12/h6-11,13-15,19-20H,1-5H3,(H,18,22)/t11-,13+,14-,15+/m1/s1 |
| InChIKey | VSTNZWYVOXMEMQ-BEAPCOKYSA-N |
| XLogP | 0.61 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|