C15H19NO6S — CID 10688597
dimethyl (2S,3S)-2-benzylsulfanyl-3-(methoxycarbonylamino)butanedioate (PubChem CID 10688597) has the molecular formula C15H19NO6S and a molecular weight of 341.39 g/mol. Its IUPAC name is dimethyl (2S,3S)-2-benzylsulfanyl-3-(methoxycarbonylamino)butanedioate.
| Compound Name | dimethyl (2S,3S)-2-benzylsulfanyl-3-(methoxycarbonylamino)butanedioate |
|---|---|
| PubChem CID | 10688597 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | dimethyl (2S,3S)-2-benzylsulfanyl-3-(methoxycarbonylamino)butanedioate |
| SMILES | COC(=O)N[C@@H](C(=O)OC)[C@H](SCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C15H19NO6S/c1-20-13(17)11(16-15(19)22-3)12(14(18)21-2)23-9-10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3,(H,16,19)/t11-,12+/m1/s1 |
| InChIKey | YIACAWRFFSCYNO-NEPJUHHUSA-N |
| XLogP | 1.36 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|