methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate

C16H15ClO2S — CID 101493270

IUPACmethyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate
SMILESCOC(=O)C(SCc1ccccc1)c1ccccc1Cl
InChIInChI=1S/C16H15ClO2S/c1-19-16(18)15(13-9-5-6-10-14(13)17)20-11-12-7-3-2-4-8-12/h2-10,15H,11H2,1H3
InChIKeyCCWSJBHOBLBVKW-UHFFFAOYSA-N
MW306.81 g/mol
LogP4.49
Rot. Bonds5

About methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate

methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate (PubChem CID 101493270) has the molecular formula C16H15ClO2S and a molecular weight of 306.81 g/mol. Its IUPAC name is methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate.

Molecular Properties

Compound Namemethyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate
PubChem CID101493270
Molecular FormulaC16H15ClO2S
Molecular Weight306.81 g/mol
Exact Mass306.05
IUPAC Namemethyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate
SMILESCOC(=O)C(SCc1ccccc1)c1ccccc1Cl
InChIInChI=1S/C16H15ClO2S/c1-19-16(18)15(13-9-5-6-10-14(13)17)20-11-12-7-3-2-4-8-12/h2-10,15H,11H2,1H3
InChIKeyCCWSJBHOBLBVKW-UHFFFAOYSA-N
XLogP4.49
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.81
LogP ≤ 54.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate?
The IUPAC name of methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate (CID 101493270) is methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate.
What is the SMILES notation for methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate?
The canonical SMILES for methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate is COC(=O)C(SCc1ccccc1)c1ccccc1Cl.
What is the InChIKey of methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate?
The InChIKey is CCWSJBHOBLBVKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO2S/c1-19-16(18)15(13-9-5-6-10-14(13)17)20-11-12-7-3-2-4-8-12/h2-10,15H,11H2,1H3.
What are the key properties of methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate?
methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate has a molecular weight of 306.81 g/mol, XLogP of 4.49, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-benzylsulfanyl-2-(2-chlorophenyl)acetate is sourced from PubChem (CID 101493270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).