C17H25NO3Si — CID 10358596
methyl (E,2S,3R)-2-acetamido-3-[dimethyl(phenyl)silyl]hex-4-enoate (PubChem CID 10358596) has the molecular formula C17H25NO3Si and a molecular weight of 319.48 g/mol. Its IUPAC name is methyl (E,2S,3R)-2-acetamido-3-[dimethyl(phenyl)silyl]hex-4-enoate.
| Compound Name | methyl (E,2S,3R)-2-acetamido-3-[dimethyl(phenyl)silyl]hex-4-enoate |
|---|---|
| PubChem CID | 10358596 |
| Molecular Formula | C17H25NO3Si |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | methyl (E,2S,3R)-2-acetamido-3-[dimethyl(phenyl)silyl]hex-4-enoate |
| SMILES | C/C=C/[C@H]([C@@H](NC(C)=O)C(=O)OC)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H25NO3Si/c1-6-10-15(16(17(20)21-3)18-13(2)19)22(4,5)14-11-8-7-9-12-14/h6-12,15-16H,1-5H3,(H,18,19)/b10-6+/t15-,16-/m1/s1 |
| InChIKey | LGZQQWJMKJJTFG-SNWBSQOPSA-N |
| XLogP | 2.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|