C21H28OSi — CID 11141904
(E,2S,3R)-2-benzyl-3-[dimethyl(phenyl)silyl]hex-4-en-1-ol (PubChem CID 11141904) has the molecular formula C21H28OSi and a molecular weight of 324.54 g/mol. Its IUPAC name is (E,2S,3R)-2-benzyl-3-[dimethyl(phenyl)silyl]hex-4-en-1-ol.
| Compound Name | (E,2S,3R)-2-benzyl-3-[dimethyl(phenyl)silyl]hex-4-en-1-ol |
|---|---|
| PubChem CID | 11141904 |
| Molecular Formula | C21H28OSi |
| Molecular Weight | 324.54 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (E,2S,3R)-2-benzyl-3-[dimethyl(phenyl)silyl]hex-4-en-1-ol |
| SMILES | C/C=C/[C@H]([C@H](CO)Cc1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H28OSi/c1-4-11-21(23(2,3)20-14-9-6-10-15-20)19(17-22)16-18-12-7-5-8-13-18/h4-15,19,21-22H,16-17H2,1-3H3/b11-4+/t19-,21+/m0/s1 |
| InChIKey | ALLTUSJRAKCDQF-YTSJMYBASA-N |
| XLogP | 4.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|