C20H34O3Si2 — CID 15049425
(E,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-[dimethyl(phenyl)silyl]hex-4-enoic acid (PubChem CID 15049425) has the molecular formula C20H34O3Si2 and a molecular weight of 378.66 g/mol. Its IUPAC name is (E,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-[dimethyl(phenyl)silyl]hex-4-enoic acid.
| Compound Name | (E,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-[dimethyl(phenyl)silyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 15049425 |
| Molecular Formula | C20H34O3Si2 |
| Molecular Weight | 378.66 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (E,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-[dimethyl(phenyl)silyl]hex-4-enoic acid |
| SMILES | C/C=C/[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C(=O)O)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H34O3Si2/c1-9-13-17(24(5,6)16-14-11-10-12-15-16)18(19(21)22)23-25(7,8)20(2,3)4/h9-15,17-18H,1-8H3,(H,21,22)/b13-9+/t17-,18-/m1/s1 |
| InChIKey | NVHPJOCPRACPOR-LJXZRRFRSA-N |
| XLogP | 5.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|