C26H46O2Si2 — CID 102097557
(2Z,4S,5R,6S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-6,8-dimethyldeca-2,9-dien-5-ol (PubChem CID 102097557) has the molecular formula C26H46O2Si2 and a molecular weight of 446.82 g/mol. Its IUPAC name is (2Z,4S,5R,6S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-6,8-dimethyldeca-2,9-dien-5-ol.
| Compound Name | (2Z,4S,5R,6S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-6,8-dimethyldeca-2,9-dien-5-ol |
|---|---|
| PubChem CID | 102097557 |
| Molecular Formula | C26H46O2Si2 |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | (2Z,4S,5R,6S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-6,8-dimethyldeca-2,9-dien-5-ol |
| SMILES | C=C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O)[C@H](/C=C\C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C26H46O2Si2/c1-12-17-23(29(8,9)22-18-15-14-16-19-22)24(27)21(4)25(20(3)13-2)28-30(10,11)26(5,6)7/h12-21,23-25,27H,2H2,1,3-11H3/b17-12-/t20-,21-,23-,24+,25-/m0/s1 |
| InChIKey | PFDNPSJITFWNHM-AVEFHUAFSA-N |
| XLogP | 6.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|