C35H48O3Si — CID 59891823
(E,4R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-8-trityloxyoct-2-en-4-ol (PubChem CID 59891823) has the molecular formula C35H48O3Si and a molecular weight of 544.85 g/mol. Its IUPAC name is (E,4R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-8-trityloxyoct-2-en-4-ol.
| Compound Name | (E,4R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-8-trityloxyoct-2-en-4-ol |
|---|---|
| PubChem CID | 59891823 |
| Molecular Formula | C35H48O3Si |
| Molecular Weight | 544.85 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | (E,4R,5S,6S,7S)-6-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-8-trityloxyoct-2-en-4-ol |
| SMILES | C/C=C/[C@@H](O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H48O3Si/c1-9-19-32(36)28(3)33(38-39(7,8)34(4,5)6)27(2)26-37-35(29-20-13-10-14-21-29,30-22-15-11-16-23-30)31-24-17-12-18-25-31/h9-25,27-28,32-33,36H,26H2,1-8H3/b19-9+/t27-,28-,32+,33-/m0/s1 |
| InChIKey | GYQYOBPCRRAJKW-QLXWPYRQSA-N |
| XLogP | 8.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.85 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|