C29H34O2S — CID 10049252
(E,3R,4S)-1-tert-butylsulfanyl-4-methyl-5-trityloxypent-1-en-3-ol (PubChem CID 10049252) has the molecular formula C29H34O2S and a molecular weight of 446.66 g/mol. Its IUPAC name is (E,3R,4S)-1-tert-butylsulfanyl-4-methyl-5-trityloxypent-1-en-3-ol.
| Compound Name | (E,3R,4S)-1-tert-butylsulfanyl-4-methyl-5-trityloxypent-1-en-3-ol |
|---|---|
| PubChem CID | 10049252 |
| Molecular Formula | C29H34O2S |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (E,3R,4S)-1-tert-butylsulfanyl-4-methyl-5-trityloxypent-1-en-3-ol |
| SMILES | C[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](O)/C=C/SC(C)(C)C |
| InChI | InChI=1S/C29H34O2S/c1-23(27(30)20-21-32-28(2,3)4)22-31-29(24-14-8-5-9-15-24,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-21,23,27,30H,22H2,1-4H3/b21-20+/t23-,27-/m0/s1 |
| InChIKey | IBIVFEWGGIAJNR-HQYLTEJJSA-N |
| XLogP | 7.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|