C36H46O2S — CID 10482480
(2E,4S,5R,6S,7E,9R)-6-tert-butylsulfanyl-3,5,9-trimethyl-10-trityloxydeca-2,7-dien-4-ol (PubChem CID 10482480) has the molecular formula C36H46O2S and a molecular weight of 542.83 g/mol. Its IUPAC name is (2E,4S,5R,6S,7E,9R)-6-tert-butylsulfanyl-3,5,9-trimethyl-10-trityloxydeca-2,7-dien-4-ol.
| Compound Name | (2E,4S,5R,6S,7E,9R)-6-tert-butylsulfanyl-3,5,9-trimethyl-10-trityloxydeca-2,7-dien-4-ol |
|---|---|
| PubChem CID | 10482480 |
| Molecular Formula | C36H46O2S |
| Molecular Weight | 542.83 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | (2E,4S,5R,6S,7E,9R)-6-tert-butylsulfanyl-3,5,9-trimethyl-10-trityloxydeca-2,7-dien-4-ol |
| SMILES | C/C=C(\C)[C@@H](O)[C@@H](C)[C@H](/C=C/[C@@H](C)COC(c1ccccc1)(c1ccccc1)c1ccccc1)SC(C)(C)C |
| InChI | InChI=1S/C36H46O2S/c1-8-28(3)34(37)29(4)33(39-35(5,6)7)25-24-27(2)26-38-36(30-18-12-9-13-19-30,31-20-14-10-15-21-31)32-22-16-11-17-23-32/h8-25,27,29,33-34,37H,26H2,1-7H3/b25-24+,28-8+/t27-,29+,33+,34-/m1/s1 |
| InChIKey | OPRYIURCKUEXTC-MKMLVDQZSA-N |
| XLogP | 9.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.83 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|