C26H25IO2 — CID 102467334
(1E,3S,4E)-1-iodo-2-methyl-6-trityloxyhexa-1,4-dien-3-ol (PubChem CID 102467334) has the molecular formula C26H25IO2 and a molecular weight of 496.39 g/mol. Its IUPAC name is (1E,3S,4E)-1-iodo-2-methyl-6-trityloxyhexa-1,4-dien-3-ol.
| Compound Name | (1E,3S,4E)-1-iodo-2-methyl-6-trityloxyhexa-1,4-dien-3-ol |
|---|---|
| PubChem CID | 102467334 |
| Molecular Formula | C26H25IO2 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | (1E,3S,4E)-1-iodo-2-methyl-6-trityloxyhexa-1,4-dien-3-ol |
| SMILES | C/C(=C\I)[C@@H](O)/C=C/COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H25IO2/c1-21(20-27)25(28)18-11-19-29-26(22-12-5-2-6-13-22,23-14-7-3-8-15-23)24-16-9-4-10-17-24/h2-18,20,25,28H,19H2,1H3/b18-11+,21-20+/t25-/m0/s1 |
| InChIKey | LFHMVEFXAYBNGN-QXHAMITJSA-N |
| XLogP | 6.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|