C29H38O4 — CID 143157541
[diphenyl-[(2S)-2-propan-2-yloxybutoxy]methyl]benzene;propane-2,2-diol (PubChem CID 143157541) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is [diphenyl-[(2S)-2-propan-2-yloxybutoxy]methyl]benzene;propane-2,2-diol.
| Compound Name | [diphenyl-[(2S)-2-propan-2-yloxybutoxy]methyl]benzene;propane-2,2-diol |
|---|---|
| PubChem CID | 143157541 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | [diphenyl-[(2S)-2-propan-2-yloxybutoxy]methyl]benzene;propane-2,2-diol |
| SMILES | CC(C)(O)O.CC[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)OC(C)C |
| InChI | InChI=1S/C26H30O2.C3H8O2/c1-4-25(28-21(2)3)20-27-26(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24;1-3(2,4)5/h5-19,21,25H,4,20H2,1-3H3;4-5H,1-2H3/t25-;/m0./s1 |
| InChIKey | NTGCAFRABZORAC-UQIIZPHYSA-N |
| XLogP | 5.91 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|