C27H30O3 — CID 135147480
propan-2-yl 2,2-dimethyl-3-trityloxypropanoate (PubChem CID 135147480) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is propan-2-yl 2,2-dimethyl-3-trityloxypropanoate.
| Compound Name | propan-2-yl 2,2-dimethyl-3-trityloxypropanoate |
|---|---|
| PubChem CID | 135147480 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | propan-2-yl 2,2-dimethyl-3-trityloxypropanoate |
| SMILES | CC(C)OC(=O)C(C)(C)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30O3/c1-21(2)30-25(28)26(3,4)20-29-27(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19,21H,20H2,1-4H3 |
| InChIKey | JGYJGBWCZWRWMI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|