C35H46O13 — CID 140999222
1-[1-[1-[1-[2-(2-phenylpropan-2-ylperoxymethyl)prop-2-enoyloxy]ethoxy]ethoxycarbonyloxy]ethoxy]ethyl 2-(2-phenylpropan-2-ylperoxymethyl)prop-2-enoate (PubChem CID 140999222) has the molecular formula C35H46O13 and a molecular weight of 674.74 g/mol. Its IUPAC name is 1-[1-[1-[1-[2-(2-phenylpropan-2-ylperoxymethyl)prop-2-enoyloxy]ethoxy]ethoxycarbonyloxy]ethoxy]ethyl 2-(2-phenylpropan-2-ylperoxymethyl)prop-2-enoate.
| Compound Name | 1-[1-[1-[1-[2-(2-phenylpropan-2-ylperoxymethyl)prop-2-enoyloxy]ethoxy]ethoxycarbonyloxy]ethoxy]ethyl 2-(2-phenylpropan-2-ylperoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 140999222 |
| Molecular Formula | C35H46O13 |
| Molecular Weight | 674.74 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | 1-[1-[1-[1-[2-(2-phenylpropan-2-ylperoxymethyl)prop-2-enoyloxy]ethoxy]ethoxycarbonyloxy]ethoxy]ethyl 2-(2-phenylpropan-2-ylperoxymethyl)prop-2-enoate |
| SMILES | C=C(COOC(C)(C)c1ccccc1)C(=O)OC(C)OC(C)OC(=O)OC(C)OC(C)OC(=O)C(=C)COOC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C35H46O13/c1-23(21-39-47-34(7,8)29-17-13-11-14-18-29)31(36)43-25(3)41-27(5)45-33(38)46-28(6)42-26(4)44-32(37)24(2)22-40-48-35(9,10)30-19-15-12-16-20-30/h11-20,25-28H,1-2,21-22H2,3-10H3 |
| InChIKey | LZUOOSNKCUZGKB-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.74 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|