C32H42NO4PS — CID 87169901
N,N-diethylethanamine;S-(2-phosphorosooxyethyl) 2,2-dimethyl-3-trityloxypropanethioate (PubChem CID 87169901) has the molecular formula C32H42NO4PS and a molecular weight of 567.73 g/mol. Its IUPAC name is N,N-diethylethanamine;S-(2-phosphorosooxyethyl) 2,2-dimethyl-3-trityloxypropanethioate.
| Compound Name | N,N-diethylethanamine;S-(2-phosphorosooxyethyl) 2,2-dimethyl-3-trityloxypropanethioate |
|---|---|
| PubChem CID | 87169901 |
| Molecular Formula | C32H42NO4PS |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | N,N-diethylethanamine;S-(2-phosphorosooxyethyl) 2,2-dimethyl-3-trityloxypropanethioate |
| SMILES | CC(C)(COC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)SCCOP=O.CCN(CC)CC |
| InChI | InChI=1S/C26H27O4PS.C6H15N/c1-25(2,24(27)32-19-18-30-31-28)20-29-26(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23;1-4-7(5-2)6-3/h3-17H,18-20H2,1-2H3;4-6H2,1-3H3 |
| InChIKey | OKVMARSBQJWEGJ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|