About cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol
cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol (PubChem CID 143910685) has the molecular formula C21H37NO2
and a molecular weight of 335.53 g/mol. Its IUPAC name is cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol.
Molecular Properties
| Compound Name | cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol |
| PubChem CID | 143910685 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol |
| SMILES | C1CCCCC1.CCN(CC)CCOC[C@@](C)(O)c1ccccc1 |
| InChI | InChI=1S/C15H25NO2.C6H12/c1-4-16(5-2)11-12-18-13-15(3,17)14-9-7-6-8-10-14;1-2-4-6-5-3-1/h6-10,17H,4-5,11-13H2,1-3H3;1-6H2/t15-;/m1./s1 |
| InChIKey | QULYJPAEALXOHO-XFULWGLBSA-N |
| XLogP | 4.59 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol?
The IUPAC name of cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol (CID 143910685) is cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol.
What is the SMILES notation for cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol?
The canonical SMILES for cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol is C1CCCCC1.CCN(CC)CCOC[C@@](C)(O)c1ccccc1.
What is the InChIKey of cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol?
The InChIKey is QULYJPAEALXOHO-XFULWGLBSA-N. The full InChI is InChI=1S/C15H25NO2.C6H12/c1-4-16(5-2)11-12-18-13-15(3,17)14-9-7-6-8-10-14;1-2-4-6-5-3-1/h6-10,17H,4-5,11-13H2,1-3H3;1-6H2/t15-;/m1./s1.
What are the key properties of cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol?
cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol has a molecular weight of 335.53 g/mol, XLogP of 4.59, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;(2S)-1-[2-(diethylamino)ethoxy]-2-phenylpropan-2-ol is sourced from PubChem (CID 143910685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).