C16H27NO — CID 20619676
2-(3-tert-butylphenoxy)-N,N-diethylethanamine (PubChem CID 20619676) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 2-(3-tert-butylphenoxy)-N,N-diethylethanamine.
| Compound Name | 2-(3-tert-butylphenoxy)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 20619676 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 2-(3-tert-butylphenoxy)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H27NO/c1-6-17(7-2)11-12-18-15-10-8-9-14(13-15)16(3,4)5/h8-10,13H,6-7,11-12H2,1-5H3 |
| InChIKey | UDEUVIFRKUJYEL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |