C14H22ClNO2 — CID 79389653
1-[2-(3-chlorophenoxy)ethyl-ethylamino]-2-methylpropan-2-ol (PubChem CID 79389653) has the molecular formula C14H22ClNO2 and a molecular weight of 271.79 g/mol. Its IUPAC name is 1-[2-(3-chlorophenoxy)ethyl-ethylamino]-2-methylpropan-2-ol.
| Compound Name | 1-[2-(3-chlorophenoxy)ethyl-ethylamino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 79389653 |
| Molecular Formula | C14H22ClNO2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-[2-(3-chlorophenoxy)ethyl-ethylamino]-2-methylpropan-2-ol |
| SMILES | CCN(CCOc1cccc(Cl)c1)CC(C)(C)O |
| InChI | InChI=1S/C14H22ClNO2/c1-4-16(11-14(2,3)17)8-9-18-13-7-5-6-12(15)10-13/h5-7,10,17H,4,8-9,11H2,1-3H3 |
| InChIKey | WASXFTOOHOPBTA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |