C12H19ClN2O — CID 103102306
N'-[2-(3-chlorophenoxy)ethyl]-N'-ethylethane-1,2-diamine (PubChem CID 103102306) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is N'-[2-(3-chlorophenoxy)ethyl]-N'-ethylethane-1,2-diamine.
| Compound Name | N'-[2-(3-chlorophenoxy)ethyl]-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 103102306 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | N'-[2-(3-chlorophenoxy)ethyl]-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCN)CCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H19ClN2O/c1-2-15(7-6-14)8-9-16-12-5-3-4-11(13)10-12/h3-5,10H,2,6-9,14H2,1H3 |
| InChIKey | JAKMMEVQRJDZOI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |