C17H21ClN2O — CID 104859131
N'-benzyl-N'-[2-(3-chlorophenoxy)ethyl]ethane-1,2-diamine (PubChem CID 104859131) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is N'-benzyl-N'-[2-(3-chlorophenoxy)ethyl]ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-[2-(3-chlorophenoxy)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 104859131 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N'-benzyl-N'-[2-(3-chlorophenoxy)ethyl]ethane-1,2-diamine |
| SMILES | NCCN(CCOc1cccc(Cl)c1)Cc1ccccc1 |
| InChI | InChI=1S/C17H21ClN2O/c18-16-7-4-8-17(13-16)21-12-11-20(10-9-19)14-15-5-2-1-3-6-15/h1-8,13H,9-12,14,19H2 |
| InChIKey | LJPXEDVLOLVGOM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |