C17H31NO2 — CID 18540426
N,N-diethylethanamine;ethyl acetate;toluene (PubChem CID 18540426) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is N,N-diethylethanamine;ethyl acetate;toluene.
| Compound Name | N,N-diethylethanamine;ethyl acetate;toluene |
|---|---|
| PubChem CID | 18540426 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | N,N-diethylethanamine;ethyl acetate;toluene |
| SMILES | CCN(CC)CC.CCOC(C)=O.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.C6H15N.C4H8O2/c1-7-5-3-2-4-6-7;1-4-7(5-2)6-3;1-3-6-4(2)5/h2-6H,1H3;4-6H2,1-3H3;3H2,1-2H3 |
| InChIKey | WUXPOBUZRMLFGI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |