C44H52N6O5PoS — CID 143717411
S-[2-[2-(6-aminopurin-9-yl)ethoxymethyl-(benzylamino)-methyl-λ4-polanyl]ethyl] 3-[bis(4-methoxyphenyl)-phenylmethoxy]-2,2-dimethylpropanethioate (PubChem CID 143717411) has the molecular formula C44H52N6O5PoS and a molecular weight of 986.00 g/mol. Its IUPAC name is S-[2-[2-(6-aminopurin-9-yl)ethoxymethyl-(benzylamino)-methyl-λ4-polanyl]ethyl] 3-[bis(4-methoxyphenyl)-phenylmethoxy]-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[2-(6-aminopurin-9-yl)ethoxymethyl-(benzylamino)-methyl-λ4-polanyl]ethyl] 3-[bis(4-methoxyphenyl)-phenylmethoxy]-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 143717411 |
| Molecular Formula | C44H52N6O5PoS |
| Molecular Weight | 986.00 g/mol |
| Exact Mass | 985.35 |
| IUPAC Name | S-[2-[2-(6-aminopurin-9-yl)ethoxymethyl-(benzylamino)-methyl-λ4-polanyl]ethyl] 3-[bis(4-methoxyphenyl)-phenylmethoxy]-2,2-dimethylpropanethioate |
| SMILES | COc1ccc(C(OCC(C)(C)C(=O)SCC[Po@](C)(COCCn2cnc3c(N)ncnc32)NCc2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H31O4S.C8H10N5O.C7H8N.CH3.Po/c1-6-33-26(29)27(2,3)20-32-28(21-10-8-7-9-11-21,22-12-16-24(30-4)17-13-22)23-14-18-25(31-5)19-15-23;1-14-3-2-13-5-12-6-7(9)10-4-11-8(6)13;8-6-7-4-2-1-3-5-7;;/h7-19H,1,6,20H2,2-5H3;4-5H,1-3H2,(H2,9,10,11);1-5,8H,6H2;1H3;/q;;-1;;+1 |
| InChIKey | AJWLIXKEUROUAL-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.00 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|