About diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate
diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate (PubChem CID 70622755) has the molecular formula C14H20N2O3
and a molecular weight of 264.33 g/mol. Its IUPAC name is diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate.
Molecular Properties
| Compound Name | diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate |
| PubChem CID | 70622755 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate |
| SMILES | CC(C)OC(=O)C(C)(C)c1ccccc1.O=C1NN1 |
| InChI | InChI=1S/C13H18O2.CH2N2O/c1-10(2)15-12(14)13(3,4)11-8-6-5-7-9-11;4-1-2-3-1/h5-10H,1-4H3;(H2,2,3,4) |
| InChIKey | CNYJFBPYWWGNQV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate?
The IUPAC name of diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate (CID 70622755) is diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate.
What is the SMILES notation for diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate?
The canonical SMILES for diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate is CC(C)OC(=O)C(C)(C)c1ccccc1.O=C1NN1.
What is the InChIKey of diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate?
The InChIKey is CNYJFBPYWWGNQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2.CH2N2O/c1-10(2)15-12(14)13(3,4)11-8-6-5-7-9-11;4-1-2-3-1/h5-10H,1-4H3;(H2,2,3,4).
What are the key properties of diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate?
diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate has a molecular weight of 264.33 g/mol, XLogP of 2.13, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diaziridin-3-one;propan-2-yl 2-methyl-2-phenylpropanoate is sourced from PubChem (CID 70622755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).