C30H64O4Si3 — CID 122219893
(2R,3R,4R,5E,7R,8S)-1,3,8-tris[[tert-butyl(dimethyl)silyl]oxy]-2,7-dimethyldeca-5,9-dien-4-ol (PubChem CID 122219893) has the molecular formula C30H64O4Si3 and a molecular weight of 573.10 g/mol. Its IUPAC name is (2R,3R,4R,5E,7R,8S)-1,3,8-tris[[tert-butyl(dimethyl)silyl]oxy]-2,7-dimethyldeca-5,9-dien-4-ol.
| Compound Name | (2R,3R,4R,5E,7R,8S)-1,3,8-tris[[tert-butyl(dimethyl)silyl]oxy]-2,7-dimethyldeca-5,9-dien-4-ol |
|---|---|
| PubChem CID | 122219893 |
| Molecular Formula | C30H64O4Si3 |
| Molecular Weight | 573.10 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | (2R,3R,4R,5E,7R,8S)-1,3,8-tris[[tert-butyl(dimethyl)silyl]oxy]-2,7-dimethyldeca-5,9-dien-4-ol |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H64O4Si3/c1-19-26(33-36(15,16)29(7,8)9)23(2)20-21-25(31)27(34-37(17,18)30(10,11)12)24(3)22-32-35(13,14)28(4,5)6/h19-21,23-27,31H,1,22H2,2-18H3/b21-20+/t23-,24-,25-,26+,27-/m1/s1 |
| InChIKey | JHABNHWDGKUGQW-JNWZGMRCSA-N |
| XLogP | 9.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.10 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|