C15H24Si — CID 52921003
dimethyl-[(Z,3S)-2-methylhex-4-en-3-yl]-phenylsilane (PubChem CID 52921003) has the molecular formula C15H24Si and a molecular weight of 232.44 g/mol. Its IUPAC name is dimethyl-[(Z,3S)-2-methylhex-4-en-3-yl]-phenylsilane.
| Compound Name | dimethyl-[(Z,3S)-2-methylhex-4-en-3-yl]-phenylsilane |
|---|---|
| PubChem CID | 52921003 |
| Molecular Formula | C15H24Si |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | dimethyl-[(Z,3S)-2-methylhex-4-en-3-yl]-phenylsilane |
| SMILES | C/C=C\[C@H](C(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H24Si/c1-6-10-15(13(2)3)16(4,5)14-11-8-7-9-12-14/h6-13,15H,1-5H3/b10-6-/t15-/m1/s1 |
| InChIKey | UVFGYCRUBJYRMD-IZIDJEDMSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|