About dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane
dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane (PubChem CID 101441777) has the molecular formula C24H26Si
and a molecular weight of 342.56 g/mol. Its IUPAC name is dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane.
Molecular Properties
| Compound Name | dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane |
| PubChem CID | 101441777 |
| Molecular Formula | C24H26Si |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane |
| SMILES | C/C=C/[C@@H](c1ccccc1-c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H26Si/c1-4-13-24(25(2,3)21-16-9-6-10-17-21)23-19-12-11-18-22(23)20-14-7-5-8-15-20/h4-19,24H,1-3H3/b13-4+/t24-/m0/s1 |
| InChIKey | PKLRYYMURNNJHQ-SERNOFLVSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane?
The IUPAC name of dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane (CID 101441777) is dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane.
What is the SMILES notation for dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane?
The canonical SMILES for dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane is C/C=C/[C@@H](c1ccccc1-c1ccccc1)[Si](C)(C)c1ccccc1.
What is the InChIKey of dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane?
The InChIKey is PKLRYYMURNNJHQ-SERNOFLVSA-N. The full InChI is InChI=1S/C24H26Si/c1-4-13-24(25(2,3)21-16-9-6-10-17-21)23-19-12-11-18-22(23)20-14-7-5-8-15-20/h4-19,24H,1-3H3/b13-4+/t24-/m0/s1.
What are the key properties of dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane?
dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane has a molecular weight of 342.56 g/mol, XLogP of 6.17, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-phenyl-[(E,1S)-1-(2-phenylphenyl)but-2-enyl]silane is sourced from PubChem (CID 101441777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).