C21H46O2Si2 — CID 72701903
tert-butyl-[(3S,4R,5S,6S)-3,5-dimethyl-6-triethylsilyloxyhept-1-en-4-yl]oxy-dimethylsilane (PubChem CID 72701903) has the molecular formula C21H46O2Si2 and a molecular weight of 386.77 g/mol. Its IUPAC name is tert-butyl-[(3S,4R,5S,6S)-3,5-dimethyl-6-triethylsilyloxyhept-1-en-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4R,5S,6S)-3,5-dimethyl-6-triethylsilyloxyhept-1-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 72701903 |
| Molecular Formula | C21H46O2Si2 |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | tert-butyl-[(3S,4R,5S,6S)-3,5-dimethyl-6-triethylsilyloxyhept-1-en-4-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H46O2Si2/c1-13-17(5)20(23-24(11,12)21(8,9)10)18(6)19(7)22-25(14-2,15-3)16-4/h13,17-20H,1,14-16H2,2-12H3/t17-,18-,19-,20+/m0/s1 |
| InChIKey | ZTDLQHIBRWVWKT-LWYYNNOASA-N |
| XLogP | 7.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|